CAS 112062-69-8 is the registry number for 3-Bromo-2-chloro-4,5-difluorobenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-bromo-2-chloro-4,5-difluorobenzoic acid (CAS 112062-69-8) is a chemical compound with the molecular formula C7H2BrClF2O2 and a molecular weight of 271.44 g/mol. IUPAC name: 3-bromo-2-chloro-4,5-difluorobenzoic acid. InChIKey: QJWUOIWVSKCFCO-UHFFFAOYSA-N.
| Molecular formula | C7H2BrClF2O2 |
|---|---|
| Molecular weight | 271.44 g/mol |
| IUPAC name | 3-bromo-2-chloro-4,5-difluorobenzoic acid |
| InChIKey | QJWUOIWVSKCFCO-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)F)Br)Cl)C(=O)O |
Computed by PubChem (NCBI)