Products 112062-69-8

CAS 112062-69-8 is the registry number for 3-Bromo-2-chloro-4,5-difluorobenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

3-bromo-2-chloro-4,5-difluorobenzoic acid (CAS 112062-69-8) is a chemical compound with the molecular formula C7H2BrClF2O2 and a molecular weight of 271.44 g/mol. IUPAC name: 3-bromo-2-chloro-4,5-difluorobenzoic acid. InChIKey: QJWUOIWVSKCFCO-UHFFFAOYSA-N.

Identity
Molecular formulaC7H2BrClF2O2
Molecular weight271.44 g/mol
IUPAC name3-bromo-2-chloro-4,5-difluorobenzoic acid
InChIKeyQJWUOIWVSKCFCO-UHFFFAOYSA-N
SMILESC1=C(C(=C(C(=C1F)F)Br)Cl)C(=O)O

Computed by PubChem (NCBI)