cas: 916737-76-3 — see every product listed under this CAS number, including other names
6-Bromo-3-methoxy-2-nitropyridine 98% (CAS 916737-76-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A449767-100mg |
| cas | 916737-76-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 242.44 Pln | |
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 542.81 Pln | |
| Ambeed | 5g | 1749.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A449767 |
6-bromo-3-methoxy-2-nitropyridine (CAS 916737-76-3) is a chemical compound with the molecular formula C6H5BrN2O3 and a molecular weight of 233.02 g/mol. IUPAC name: 6-bromo-3-methoxy-2-nitropyridine. InChIKey: NCYGJPLRMYGVEB-UHFFFAOYSA-N.
| Molecular formula | C6H5BrN2O3 |
|---|---|
| Molecular weight | 233.02 g/mol |
| IUPAC name | 6-bromo-3-methoxy-2-nitropyridine |
| InChIKey | NCYGJPLRMYGVEB-UHFFFAOYSA-N |
| SMILES | COC1=C(N=C(C=C1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)