cas: 203506-01-8 — see every product listed under this CAS number, including other names
6-Bromo-3-methyl-quinolin-2-amine, 98% (CAS 203506-01-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F719260-100MG |
| cas | 203506-01-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 362.39 Pln | |
| Fluorochem | 250mg | 518.59 Pln | |
| Fluorochem | 1g | 1226.67 Pln | |
| Fluorochem | 5g | 3954.88 Pln | |
| Fluorochem | 10g | 6563.33 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
6-bromo-3-methylquinolin-2-amine (CAS 203506-01-8) is a chemical compound with the molecular formula C10H9BrN2 and a molecular weight of 237.10 g/mol. IUPAC name: 6-bromo-3-methylquinolin-2-amine. InChIKey: DUFGQFDKOSMTAO-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2 |
|---|---|
| Molecular weight | 237.10 g/mol |
| IUPAC name | 6-bromo-3-methylquinolin-2-amine |
| InChIKey | DUFGQFDKOSMTAO-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=CC(=C2)Br)N=C1N |
Computed by PubChem (NCBI)