CAS 2304753-12-4 appears in our catalog under these names: 5-Bromo-n-methyl-8-quinolinamine, 95%, 8-Quinolinamine, 5-bromo-N-methyl-, 97%, 97%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 250mg, 100mg.
5-bromo-N-methylquinolin-8-amine (CAS 2304753-12-4) is a chemical compound with the molecular formula C10H9BrN2 and a molecular weight of 237.10 g/mol. IUPAC name: 5-bromo-N-methylquinolin-8-amine. InChIKey: LUGWPDNGUXZDSN-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2 |
|---|---|
| Molecular weight | 237.10 g/mol |
| IUPAC name | 5-bromo-N-methylquinolin-8-amine |
| InChIKey | LUGWPDNGUXZDSN-UHFFFAOYSA-N |
| SMILES | CNC1=C2C(=C(C=C1)Br)C=CC=N2 |
Computed by PubChem (NCBI)