cas: 784150-40-9 — see every product listed under this CAS number, including other names
6-Bromo-4-chloro-7-(phenylsulfonyl)-7H-pyrrolo[2,3-d]pyrimidine, 97%, 97% (CAS 784150-40-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GA37-1g |
| cas | 784150-40-9 |
| size | 1g |
| availability | 1.8g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 2363.60 Pln | |
| Chemat | 100mg | 554.00 Pln | |
| Chemat | 250mg | 885.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
7-(benzenesulfonyl)-6-bromo-4-chloropyrrolo[2,3-d]pyrimidine (CAS 784150-40-9) is a chemical compound with the molecular formula C12H7BrClN3O2S and a molecular weight of 372.63 g/mol. IUPAC name: 7-(benzenesulfonyl)-6-bromo-4-chloropyrrolo[2,3-d]pyrimidine. InChIKey: PKQJRAVOLLAADZ-UHFFFAOYSA-N.
| Molecular formula | C12H7BrClN3O2S |
|---|---|
| Molecular weight | 372.63 g/mol |
| IUPAC name | 7-(benzenesulfonyl)-6-bromo-4-chloropyrrolo[2,3-d]pyrimidine |
| InChIKey | PKQJRAVOLLAADZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N2C(=CC3=C2N=CN=C3Cl)Br |
Computed by PubChem (NCBI)