cas: 784150-40-9 — see every product listed under this CAS number, including other names
6-Bromo-4-chloro-7-(phenylsulfonyl)-7H-pyrrolo[2,3-d]pyrimidine, 97% (CAS 784150-40-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F463672-100MG |
| cas | 784150-40-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 664.37 Pln | |
| Fluorochem | 250mg | 1075.68 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
7-(benzenesulfonyl)-6-bromo-4-chloropyrrolo[2,3-d]pyrimidine (CAS 784150-40-9) is a chemical compound with the molecular formula C12H7BrClN3O2S and a molecular weight of 372.63 g/mol. IUPAC name: 7-(benzenesulfonyl)-6-bromo-4-chloropyrrolo[2,3-d]pyrimidine. InChIKey: PKQJRAVOLLAADZ-UHFFFAOYSA-N.
| Molecular formula | C12H7BrClN3O2S |
|---|---|
| Molecular weight | 372.63 g/mol |
| IUPAC name | 7-(benzenesulfonyl)-6-bromo-4-chloropyrrolo[2,3-d]pyrimidine |
| InChIKey | PKQJRAVOLLAADZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N2C(=CC3=C2N=CN=C3Cl)Br |
Computed by PubChem (NCBI)