6-Bromo-5-Methoxy-1H-Pyrazolo[4,3-b]Pyridine, 97%
cas: 1351813-60-9 — see every product listed under this CAS number, including other names
6-Bromo-5-Methoxy-1H-Pyrazolo[4,3-b]Pyridine, 97% (CAS 1351813-60-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch12JW36-100mg |
| cas | 1351813-60-9 |
| size | 100mg |
| availability | 10g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 578.00 Pln | |
| Chemat | 250mg | 1043.60 Pln | |
| Chemat | 500mg | 2013.20 Pln | |
| Chemat | 1g | 2699.60 Pln | |
| Chemat | 5g | 6558.80 Pln | |
| Chemat | 10g | 12995.60 Pln | |
| Fluorochem | 100mg | 1060.06 Pln | |
| Fluorochem | 250mg | 1929.55 Pln | |
| Fluorochem | 500mg | 3725.79 Pln | |
| Fluorochem | 1g | 5006.59 Pln | |
| Fluorochem | 5g | 11962.47 Pln | |
| Fluorochem | 10g | 23749.99 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
6-bromo-5-methoxy-1H-pyrazolo[4,3-b]pyridine (CAS 1351813-60-9) is a chemical compound with the molecular formula C7H6BrN3O and a molecular weight of 228.05 g/mol. IUPAC name: 6-bromo-5-methoxy-1H-pyrazolo[4,3-b]pyridine. InChIKey: TZLYQQMYXHAIOQ-UHFFFAOYSA-N.
| Molecular formula | C7H6BrN3O |
|---|---|
| Molecular weight | 228.05 g/mol |
| IUPAC name | 6-bromo-5-methoxy-1H-pyrazolo[4,3-b]pyridine |
| InChIKey | TZLYQQMYXHAIOQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=N1)C=NN2)Br |
Computed by PubChem (NCBI)