CAS 709652-84-6 appears in our catalog under these names: 7-Bromo-1h,2h,3h,4h-pyrido[2,3-b]pyrazin-2-one, 95%, 7-bromo-1H,2H,3H,4H-pyrido(2,3-b)pyrazin-2-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
7-bromo-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-2-one (CAS 709652-84-6) is a chemical compound with the molecular formula C7H6BrN3O and a molecular weight of 228.05 g/mol. IUPAC name: 7-bromo-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-2-one. InChIKey: YUBCVDJYDUKAAJ-UHFFFAOYSA-N.
| Molecular formula | C7H6BrN3O |
|---|---|
| Molecular weight | 228.05 g/mol |
| IUPAC name | 7-bromo-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-2-one |
| InChIKey | YUBCVDJYDUKAAJ-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(N1)N=CC(=C2)Br |
Computed by PubChem (NCBI)