6-Bromo-8-(3-fluorobenzyl)imidazo[1,2-a]pyrazine, 95%
cas: 2201049-54-7 — see every product listed under this CAS number, including other names
6-Bromo-8-(3-fluorobenzyl)imidazo[1,2-a]pyrazine, 95% (CAS 2201049-54-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1497090-100mg |
| cas | 2201049-54-7 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 270.25 Pln | |
| Ambeed | 250mg | 414.88 Pln | |
| Ambeed | 1g | 1015.62 Pln | |
| Chemat | 100mg | 275.60 Pln | |
| Chemat | 250mg | 424.40 Pln | |
| Chemat | 1g | 1499.60 Pln | |
| BLDpharm | 100mg | 286.59 Pln | |
| BLDpharm | 250mg | 442.09 Pln | |
| BLDpharm | 1g | 1058.54 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
6-bromo-8-[(3-fluorophenyl)methyl]imidazo[1,2-a]pyrazine (CAS 2201049-54-7) is a chemical compound with the molecular formula C13H9BrFN3 and a molecular weight of 306.13 g/mol. IUPAC name: 6-bromo-8-[(3-fluorophenyl)methyl]imidazo[1,2-a]pyrazine. InChIKey: GTGQLQJJYAEGQI-UHFFFAOYSA-N.
| Molecular formula | C13H9BrFN3 |
|---|---|
| Molecular weight | 306.13 g/mol |
| IUPAC name | 6-bromo-8-[(3-fluorophenyl)methyl]imidazo[1,2-a]pyrazine |
| InChIKey | GTGQLQJJYAEGQI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)CC2=NC(=CN3C2=NC=C3)Br |
Computed by PubChem (NCBI)