CAS 2201049-52-5 is the registry number for 6-Bromo-8-(2-fluorobenzyl)imidazo[1,2-a]pyrazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-8-[(2-fluorophenyl)methyl]imidazo[1,2-a]pyrazine (CAS 2201049-52-5) is a chemical compound with the molecular formula C13H9BrFN3 and a molecular weight of 306.13 g/mol. IUPAC name: 6-bromo-8-[(2-fluorophenyl)methyl]imidazo[1,2-a]pyrazine. InChIKey: XUPCPHUDTSBFFP-UHFFFAOYSA-N.
| Molecular formula | C13H9BrFN3 |
|---|---|
| Molecular weight | 306.13 g/mol |
| IUPAC name | 6-bromo-8-[(2-fluorophenyl)methyl]imidazo[1,2-a]pyrazine |
| InChIKey | XUPCPHUDTSBFFP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC2=NC(=CN3C2=NC=C3)Br)F |
Computed by PubChem (NCBI)