cas: 19075-45-7 — see every product listed under this CAS number, including other names
6-Bromobenzo[b]thiophene-2-carbaldehyde 96% (CAS 19075-45-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A412594-100mg |
| cas | 19075-45-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 225.75 Pln | |
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 748.62 Pln | |
| Ambeed | 5g | 2478.56 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A412594 |
6-bromo-1-benzothiophene-2-carbaldehyde (CAS 19075-45-7) is a chemical compound with the molecular formula C9H5BrOS and a molecular weight of 241.11 g/mol. IUPAC name: 6-bromo-1-benzothiophene-2-carbaldehyde. InChIKey: CENQBZNSQSCMTO-UHFFFAOYSA-N.
| Molecular formula | C9H5BrOS |
|---|---|
| Molecular weight | 241.11 g/mol |
| IUPAC name | 6-bromo-1-benzothiophene-2-carbaldehyde |
| InChIKey | CENQBZNSQSCMTO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)SC(=C2)C=O |
Computed by PubChem (NCBI)