cas: 19075-45-7 — see every product listed under this CAS number, including other names
6-Bromo-benzo[b]thiophene-2-carbaldehyde, 97% (CAS 19075-45-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F075362-100MG |
| cas | 19075-45-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 206.20 Pln | |
| Fluorochem | 250mg | 289.50 Pln | |
| Fluorochem | 500mg | 518.59 Pln | |
| Fluorochem | 1g | 732.05 Pln | |
| Fluorochem | 5g | 2471.02 Pln | |
| Fluorochem | 10g | 4043.39 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
6-bromo-1-benzothiophene-2-carbaldehyde (CAS 19075-45-7) is a chemical compound with the molecular formula C9H5BrOS and a molecular weight of 241.11 g/mol. IUPAC name: 6-bromo-1-benzothiophene-2-carbaldehyde. InChIKey: CENQBZNSQSCMTO-UHFFFAOYSA-N.
| Molecular formula | C9H5BrOS |
|---|---|
| Molecular weight | 241.11 g/mol |
| IUPAC name | 6-bromo-1-benzothiophene-2-carbaldehyde |
| InChIKey | CENQBZNSQSCMTO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)SC(=C2)C=O |
Computed by PubChem (NCBI)