6-Bromobenzo[h]quinoline, 97%
cas: 30727-61-8 — see every product listed under this CAS number, including other names
6-Bromobenzo[h]quinoline, 97% (CAS 30727-61-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A815851-100mg |
| cas | 30727-61-8 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 159.00 Pln | |
| Ambeed | 250mg | 248.00 Pln | |
| Ambeed | 1g | 604.00 Pln | |
| Ambeed | 5g | 2211.56 Pln | |
| BLDpharm | 100mg | 147.75 Pln | |
| BLDpharm | 250mg | 242.16 Pln | |
| BLDpharm | 1g | 597.59 Pln | |
| BLDpharm | 5g | 2174.81 Pln | |
| Chemat | 100mg | 227.60 Pln | |
| Chemat | 250mg | 347.60 Pln | |
| Chemat | 1g | 750.80 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
6-bromobenzo[h]quinoline (CAS 30727-61-8) is a chemical compound with the molecular formula C13H8BrN and a molecular weight of 258.11 g/mol. IUPAC name: 6-bromobenzo[h]quinoline. InChIKey: OMHXBRAVEDGICZ-UHFFFAOYSA-N.
| Molecular formula | C13H8BrN |
|---|---|
| Molecular weight | 258.11 g/mol |
| IUPAC name | 6-bromobenzo[h]quinoline |
| InChIKey | OMHXBRAVEDGICZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC3=C2N=CC=C3)Br |
Computed by PubChem (NCBI)