CAS 798545-30-9 appears in our catalog under these names: 6–Bromoquinoline–3–carboxylic acid, 3-Quinolinecarboxylic acid, 6-bromo-, 96%, 96%, 6-BROMOQUINOLINE-3-CARBOXYLIC ACID, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 250mg, 5g, 100mg, 25g.
6-bromoquinoline-3-carboxylic acid (CAS 798545-30-9) is a chemical compound with the molecular formula C10H6BrNO2 and a molecular weight of 252.06 g/mol. IUPAC name: 6-bromoquinoline-3-carboxylic acid. InChIKey: HVNYDSMSHWJYHG-UHFFFAOYSA-N.
| Molecular formula | C10H6BrNO2 |
|---|---|
| Molecular weight | 252.06 g/mol |
| IUPAC name | 6-bromoquinoline-3-carboxylic acid |
| InChIKey | HVNYDSMSHWJYHG-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=C(C=C2C=C1Br)C(=O)O |
Computed by PubChem (NCBI)