cas: 1073353-82-8 — see every product listed under this CAS number, including other names
6-Chloro-1-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole 98% (CAS 1073353-82-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A638928-250mg |
| cas | 1073353-82-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 726.38 Pln | |
| Ambeed | 5g | 2244.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A638928 |
6-chloro-1-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole (CAS 1073353-82-8) is a chemical compound with the molecular formula C15H19BClNO2 and a molecular weight of 291.6 g/mol. IUPAC name: 6-chloro-1-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole. InChIKey: XSLOXVSTSLRQFE-UHFFFAOYSA-N.
| Molecular formula | C15H19BClNO2 |
|---|---|
| Molecular weight | 291.6 g/mol |
| IUPAC name | 6-chloro-1-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole |
| InChIKey | XSLOXVSTSLRQFE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(N2C)C=C(C=C3)Cl |
Computed by PubChem (NCBI)