CAS 221548-24-9 appears in our catalog under these names: 6-Chloro-2,5-dimethylbenzoimidazole, 97%, 6-Chloro-2,5-dimethylbenzoimidazole, 97%, 97%, 6-Chloro-2,5-dimethyl-1H-benzo[d]imidazole, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 25g, 1g, 5g, 100mg, 250mg.
5-chloro-2,6-dimethyl-1H-benzimidazole (CAS 221548-24-9) is a chemical compound with the molecular formula C9H9ClN2 and a molecular weight of 180.63 g/mol. IUPAC name: 5-chloro-2,6-dimethyl-1H-benzimidazole. InChIKey: DIYFYTRPWDXBDY-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2 |
|---|---|
| Molecular weight | 180.63 g/mol |
| IUPAC name | 5-chloro-2,6-dimethyl-1H-benzimidazole |
| InChIKey | DIYFYTRPWDXBDY-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1Cl)N=C(N2)C |
Computed by PubChem (NCBI)