cas: 883-92-1 — see every product listed under this CAS number, including other names
6-Chloro-2-Oxo-2H-Chromene-3-Carboxylic Acid, 95%, 95% (CAS 883-92-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115FDK-1g |
| cas | 883-92-1 |
| size | 1g |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 122.00 Pln | |
| Chemat | 5g | 290.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
6-chloro-2-oxochromene-3-carboxylic acid (CAS 883-92-1) is a chemical compound with the molecular formula C10H5ClO4 and a molecular weight of 224.59 g/mol. IUPAC name: 6-chloro-2-oxochromene-3-carboxylic acid. InChIKey: FOEGEQQPOKZIAB-UHFFFAOYSA-N.
| Molecular formula | C10H5ClO4 |
|---|---|
| Molecular weight | 224.59 g/mol |
| IUPAC name | 6-chloro-2-oxochromene-3-carboxylic acid |
| InChIKey | FOEGEQQPOKZIAB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C=C(C(=O)O2)C(=O)O |
Computed by PubChem (NCBI)