CAS 883-92-1 appears in our catalog under these names: 6-Chloro-2-oxo-2h-chromene-3-carboxylic acid, 95%, 6-Chloro-2-Oxo-2H-Chromene-3-Carboxylic Acid, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 25g.
6-chloro-2-oxochromene-3-carboxylic acid (CAS 883-92-1) is a chemical compound with the molecular formula C10H5ClO4 and a molecular weight of 224.59 g/mol. IUPAC name: 6-chloro-2-oxochromene-3-carboxylic acid. InChIKey: FOEGEQQPOKZIAB-UHFFFAOYSA-N.
| Molecular formula | C10H5ClO4 |
|---|---|
| Molecular weight | 224.59 g/mol |
| IUPAC name | 6-chloro-2-oxochromene-3-carboxylic acid |
| InChIKey | FOEGEQQPOKZIAB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C=C(C(=O)O2)C(=O)O |
Computed by PubChem (NCBI)