Products 1260664-25-2
CAS 1260664-25-2 is the registry number for 6-Chloro-3,4-dihydro-2,7-naphthyridin-1(2H)-one, 97%, 97%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
6-chloro-3,4-dihydro-2H-2,7-naphthyridin-1-one (CAS 1260664-25-2) is a chemical compound with the molecular formula C8H7ClN2O and a molecular weight of 182.61 g/mol. IUPAC name: 6-chloro-3,4-dihydro-2H-2,7-naphthyridin-1-one. InChIKey: HIYMBIVPJMPXMK-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O |
|---|---|
| Molecular weight | 182.61 g/mol |
| IUPAC name | 6-chloro-3,4-dihydro-2H-2,7-naphthyridin-1-one |
| InChIKey | HIYMBIVPJMPXMK-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)C2=CN=C(C=C21)Cl |
Computed by PubChem (NCBI)