cas: 1221171-95-4 — see every product listed under this CAS number, including other names
6-Chloro-3-iodo-2-(trifluoromethoxy)pyridine 95% (CAS 1221171-95-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A897612-100mg |
| cas | 1221171-95-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 464.94 Pln | |
| Ambeed | 250mg | 859.88 Pln | |
| Ambeed | 1g | 2000.19 Pln | |
| Ambeed | 5g | 6817.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A897612 |
6-chloro-3-iodo-2-(trifluoromethoxy)pyridine (CAS 1221171-95-4) is a chemical compound with the molecular formula C6H2ClF3INO and a molecular weight of 323.44 g/mol. IUPAC name: 6-chloro-3-iodo-2-(trifluoromethoxy)pyridine. InChIKey: AFPPAOOKEWWCBK-UHFFFAOYSA-N.
| Molecular formula | C6H2ClF3INO |
|---|---|
| Molecular weight | 323.44 g/mol |
| IUPAC name | 6-chloro-3-iodo-2-(trifluoromethoxy)pyridine |
| InChIKey | AFPPAOOKEWWCBK-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1I)OC(F)(F)F)Cl |
Computed by PubChem (NCBI)