cas: 1221171-95-4 — see every product listed under this CAS number, including other names
6-Chloro-3-iodo-2-(trifluoromethoxy)pyridine, 95%, 95% (CAS 1221171-95-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1127RQ-100mg |
| cas | 1221171-95-4 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 357.20 Pln | |
| Chemat | 250mg | 736.40 Pln | |
| Chemat | 1g | 1730.00 Pln | |
| Chemat | 5g | 6741.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
6-chloro-3-iodo-2-(trifluoromethoxy)pyridine (CAS 1221171-95-4) is a chemical compound with the molecular formula C6H2ClF3INO and a molecular weight of 323.44 g/mol. IUPAC name: 6-chloro-3-iodo-2-(trifluoromethoxy)pyridine. InChIKey: AFPPAOOKEWWCBK-UHFFFAOYSA-N.
| Molecular formula | C6H2ClF3INO |
|---|---|
| Molecular weight | 323.44 g/mol |
| IUPAC name | 6-chloro-3-iodo-2-(trifluoromethoxy)pyridine |
| InChIKey | AFPPAOOKEWWCBK-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1I)OC(F)(F)F)Cl |
Computed by PubChem (NCBI)