cas: 1156542-25-4 — see every product listed under this CAS number, including other names
6-Chloro-4-(trifluoromethyl)picolinonitrile, 97%, 97% (CAS 1156542-25-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111GOV-100mg |
| cas | 1156542-25-4 |
| size | 100mg |
| availability | 8g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 587.60 Pln | |
| Chemat | 250mg | 731.60 Pln | |
| Chemat | 1g | 1917.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
6-chloro-4-(trifluoromethyl)pyridine-2-carbonitrile (CAS 1156542-25-4) is a chemical compound with the molecular formula C7H2ClF3N2 and a molecular weight of 206.55 g/mol. IUPAC name: 6-chloro-4-(trifluoromethyl)pyridine-2-carbonitrile. InChIKey: HQVYLNKDLDHDMB-UHFFFAOYSA-N.
| Molecular formula | C7H2ClF3N2 |
|---|---|
| Molecular weight | 206.55 g/mol |
| IUPAC name | 6-chloro-4-(trifluoromethyl)pyridine-2-carbonitrile |
| InChIKey | HQVYLNKDLDHDMB-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(N=C1C#N)Cl)C(F)(F)F |
Computed by PubChem (NCBI)