cas: 6036-64-2 — see every product listed under this CAS number, including other names
6-Chloro-5-Nitro-Pyrimidine-2,4-Diamine, 95%, 95% (CAS 6036-64-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11484N-100mg |
| cas | 6036-64-2 |
| size | 100mg |
| availability | 0.12g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 750.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
6-chloro-5-nitropyrimidine-2,4-diamine (CAS 6036-64-2) is a chemical compound with the molecular formula C4H4ClN5O2 and a molecular weight of 189.56 g/mol. IUPAC name: 6-chloro-5-nitropyrimidine-2,4-diamine. InChIKey: PQRPNYCCQLFXNK-UHFFFAOYSA-N.
| Molecular formula | C4H4ClN5O2 |
|---|---|
| Molecular weight | 189.56 g/mol |
| IUPAC name | 6-chloro-5-nitropyrimidine-2,4-diamine |
| InChIKey | PQRPNYCCQLFXNK-UHFFFAOYSA-N |
| SMILES | C1(=C(N=C(N=C1Cl)N)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)