CAS 6036-64-2 appears in our catalog under these names: 6-Chloro-5-nitropyrimidine-2,4-diamine, 95%, 6–chloro–5–nitropyrimidine–2,4–diamine, 6-Chloro-5-Nitro-Pyrimidine-2,4-Diamine, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
6-chloro-5-nitropyrimidine-2,4-diamine (CAS 6036-64-2) is a chemical compound with the molecular formula C4H4ClN5O2 and a molecular weight of 189.56 g/mol. IUPAC name: 6-chloro-5-nitropyrimidine-2,4-diamine. InChIKey: PQRPNYCCQLFXNK-UHFFFAOYSA-N.
| Molecular formula | C4H4ClN5O2 |
|---|---|
| Molecular weight | 189.56 g/mol |
| IUPAC name | 6-chloro-5-nitropyrimidine-2,4-diamine |
| InChIKey | PQRPNYCCQLFXNK-UHFFFAOYSA-N |
| SMILES | C1(=C(N=C(N=C1Cl)N)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)