cas: 585544-22-5 — see every product listed under this CAS number, including other names
6-Chloro-N-cyclopropylnicotinamide 95+% (CAS 585544-22-5) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A429188-1g |
| cas | 585544-22-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 359.25 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A429188 |
6-chloro-N-cyclopropylpyridine-3-carboxamide (CAS 585544-22-5) is a chemical compound with the molecular formula C9H9ClN2O and a molecular weight of 196.63 g/mol. IUPAC name: 6-chloro-N-cyclopropylpyridine-3-carboxamide. InChIKey: PMSOZHXVTCVGRS-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2O |
|---|---|
| Molecular weight | 196.63 g/mol |
| IUPAC name | 6-chloro-N-cyclopropylpyridine-3-carboxamide |
| InChIKey | PMSOZHXVTCVGRS-UHFFFAOYSA-N |
| SMILES | C1CC1NC(=O)C2=CN=C(C=C2)Cl |
Computed by PubChem (NCBI)