cas: 138642-97-4 — see every product listed under this CAS number, including other names
6-Chloroimidazo[1,2-a]pyridine-3-carboxylic acid 97% (CAS 138642-97-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A172881-250mg |
| cas | 138642-97-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 248.00 Pln | |
| Ambeed | 1g | 370.38 Pln | |
| Ambeed | 5g | 1538.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A172881 |
6-chloroimidazo[1,2-a]pyridine-3-carboxylic acid (CAS 138642-97-4) is a chemical compound with the molecular formula C8H5ClN2O2 and a molecular weight of 196.59 g/mol. IUPAC name: 6-chloroimidazo[1,2-a]pyridine-3-carboxylic acid. InChIKey: LXRDUEDQFSBROM-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O2 |
|---|---|
| Molecular weight | 196.59 g/mol |
| IUPAC name | 6-chloroimidazo[1,2-a]pyridine-3-carboxylic acid |
| InChIKey | LXRDUEDQFSBROM-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=C(N2C=C1Cl)C(=O)O |
Computed by PubChem (NCBI)