cas: 1260641-86-8 — see every product listed under this CAS number, including other names
6-Fluoro-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid, 95%, 95% (CAS 1260641-86-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111QXJ-100mg |
| cas | 1260641-86-8 |
| size | 100mg |
| availability | 0.73g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 208.40 Pln | |
| Chemat | 250mg | 309.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
6-fluoro-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid (CAS 1260641-86-8) is a chemical compound with the molecular formula C10H10FNO2 and a molecular weight of 195.19 g/mol. IUPAC name: 6-fluoro-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid. InChIKey: OXOUVNLVPPEGSB-UHFFFAOYSA-N.
| Molecular formula | C10H10FNO2 |
|---|---|
| Molecular weight | 195.19 g/mol |
| IUPAC name | 6-fluoro-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid |
| InChIKey | OXOUVNLVPPEGSB-UHFFFAOYSA-N |
| SMILES | C1CNC(C2=C1C=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)