cas: 60374-42-7 — see every product listed under this CAS number, including other names
6-HYDROXY-3-ISOPROPYL-1H-BENZO[C][1,2,6]THIADIAZIN-4(3H)-ONE 2,2-DIOXIDE, 95% (CAS 60374-42-7) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F796344-10MG |
| cas | 60374-42-7 |
| size | 10mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 10mg | 763.29 Pln | |
| Fluorochem | 25mg | 1450.55 Pln | |
| Fluorochem | 50mg | 2424.16 Pln | |
| Fluorochem | 100mg | 4064.21 Pln | |
| Fluorochem | 250mg | 6854.90 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
6-hydroxy-2,2-dioxo-3-propan-2-yl-1H-2lambda6,1,3-benzothiadiazin-4-one (CAS 60374-42-7) is a chemical compound with the molecular formula C10H12N2O4S and a molecular weight of 256.28 g/mol. IUPAC name: 6-hydroxy-2,2-dioxo-3-propan-2-yl-1H-2lambda6,1,3-benzothiadiazin-4-one. InChIKey: PVKWIOBXPPFARA-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O4S |
|---|---|
| Molecular weight | 256.28 g/mol |
| IUPAC name | 6-hydroxy-2,2-dioxo-3-propan-2-yl-1H-2lambda6,1,3-benzothiadiazin-4-one |
| InChIKey | PVKWIOBXPPFARA-UHFFFAOYSA-N |
| SMILES | CC(C)N1C(=O)C2=C(C=CC(=C2)O)NS1(=O)=O |
Computed by PubChem (NCBI)