CAS 60374-42-7 appears in our catalog under these names: 6-Hydroxy bentazon, 95%, 6-Hydroxy Bentazon, >95% (HPLC), Bentazone-6-hydroxy, 6–Hydroxybentazon (6–Hydroxybentazone), 6-Hydroxybentazon, 99.91%. Offered by: Combi-blocks, TRC, Dr. Ehrenstorfer, GLPBio, MedChemExpress. Available pack sizes: 250mg, 1g, 10mg, 1mg, 5mg, 10 mg, 10mM/1mL, 5 mg.
6-hydroxy-2,2-dioxo-3-propan-2-yl-1H-2lambda6,1,3-benzothiadiazin-4-one (CAS 60374-42-7) is a chemical compound with the molecular formula C10H12N2O4S and a molecular weight of 256.28 g/mol. IUPAC name: 6-hydroxy-2,2-dioxo-3-propan-2-yl-1H-2lambda6,1,3-benzothiadiazin-4-one. InChIKey: PVKWIOBXPPFARA-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O4S |
|---|---|
| Molecular weight | 256.28 g/mol |
| IUPAC name | 6-hydroxy-2,2-dioxo-3-propan-2-yl-1H-2lambda6,1,3-benzothiadiazin-4-one |
| InChIKey | PVKWIOBXPPFARA-UHFFFAOYSA-N |
| SMILES | CC(C)N1C(=O)C2=C(C=CC(=C2)O)NS1(=O)=O |
Computed by PubChem (NCBI)