cas: 320405-84-3 — see every product listed under this CAS number, including other names
6-Hydroxy-5-nitronicotinonitrile, 95% (CAS 320405-84-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F209387-100MG |
| cas | 320405-84-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 622.72 Pln | |
| Fluorochem | 250mg | 1002.79 Pln | |
| Fluorochem | 1g | 2424.16 Pln | |
| Fluorochem | 5g | 6636.22 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
5-nitro-6-oxo-1H-pyridine-3-carbonitrile (CAS 320405-84-3) is a chemical compound with the molecular formula C6H3N3O3 and a molecular weight of 165.11 g/mol. IUPAC name: 5-nitro-6-oxo-1H-pyridine-3-carbonitrile. InChIKey: SSYCVCKERZMXLP-UHFFFAOYSA-N.
| Molecular formula | C6H3N3O3 |
|---|---|
| Molecular weight | 165.11 g/mol |
| IUPAC name | 5-nitro-6-oxo-1H-pyridine-3-carbonitrile |
| InChIKey | SSYCVCKERZMXLP-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)NC=C1C#N)[N+](=O)[O-] |
Computed by PubChem (NCBI)