CAS 1210045-03-6 is the registry number for 1,3,5-Triazine-2,4,6-tricarbaldehyde, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1,3,5-triazine-2,4,6-tricarbaldehyde (CAS 1210045-03-6) is a chemical compound with the molecular formula C6H3N3O3 and a molecular weight of 165.11 g/mol. IUPAC name: 1,3,5-triazine-2,4,6-tricarbaldehyde. InChIKey: NRVHZCZYBNCGHM-UHFFFAOYSA-N.
| Molecular formula | C6H3N3O3 |
|---|---|
| Molecular weight | 165.11 g/mol |
| IUPAC name | 1,3,5-triazine-2,4,6-tricarbaldehyde |
| InChIKey | NRVHZCZYBNCGHM-UHFFFAOYSA-N |
| SMILES | C(=O)C1=NC(=NC(=N1)C=O)C=O |
Computed by PubChem (NCBI)