cas: 99455-01-3 — see every product listed under this CAS number, including other names
6-Iodo-1H-Quinolin-2-One, 96%, 96% (CAS 99455-01-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1147NE-100mg |
| cas | 99455-01-3 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 179.60 Pln | |
| Chemat | 1g | 342.80 Pln | |
| Chemat | 5g | 1106.00 Pln | |
| Chemat | 10g | 1730.00 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
6-iodo-1H-quinolin-2-one (CAS 99455-01-3) is a chemical compound with the molecular formula C9H6INO and a molecular weight of 271.05 g/mol. IUPAC name: 6-iodo-1H-quinolin-2-one. InChIKey: HRQARRHZNIORQE-UHFFFAOYSA-N.
| Molecular formula | C9H6INO |
|---|---|
| Molecular weight | 271.05 g/mol |
| IUPAC name | 6-iodo-1H-quinolin-2-one |
| InChIKey | HRQARRHZNIORQE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=O)N2)C=C1I |
Computed by PubChem (NCBI)