cas: 2002-59-7 — see every product listed under this CAS number, including other names
6-Mercapto-9H-purin-2-ol, 98% (CAS 2002-59-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F077106-250MG |
| cas | 2002-59-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 325.94 Pln | |
| Fluorochem | 1g | 1039.24 Pln | |
| Fluorochem | 5g | 4548.42 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
6-sulfanylidene-3,7-dihydropurin-2-one (CAS 2002-59-7) is a chemical compound with the molecular formula C5H4N4OS and a molecular weight of 168.18 g/mol. IUPAC name: 6-sulfanylidene-3,7-dihydropurin-2-one. InChIKey: RJOXFJDOUQJOMQ-UHFFFAOYSA-N.
| Molecular formula | C5H4N4OS |
|---|---|
| Molecular weight | 168.18 g/mol |
| IUPAC name | 6-sulfanylidene-3,7-dihydropurin-2-one |
| InChIKey | RJOXFJDOUQJOMQ-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(N1)C(=S)NC(=O)N2 |
Computed by PubChem (NCBI)