cas: 2002-59-7 — see every product listed under this CAS number, including other names
6-Thioxo-1,3,6,9-tetrahydro-2H-purin-2-one, 98%, 98% (CAS 2002-59-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 50mg, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113CM2-1g |
| cas | 2002-59-7 |
| size | 1g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 736.40 Pln | |
| Chemat | 50mg | 98.00 Pln | |
| Chemat | 5g | 2762.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
6-sulfanylidene-3,7-dihydropurin-2-one (CAS 2002-59-7) is a chemical compound with the molecular formula C5H4N4OS and a molecular weight of 168.18 g/mol. IUPAC name: 6-sulfanylidene-3,7-dihydropurin-2-one. InChIKey: RJOXFJDOUQJOMQ-UHFFFAOYSA-N.
| Molecular formula | C5H4N4OS |
|---|---|
| Molecular weight | 168.18 g/mol |
| IUPAC name | 6-sulfanylidene-3,7-dihydropurin-2-one |
| InChIKey | RJOXFJDOUQJOMQ-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(N1)C(=S)NC(=O)N2 |
Computed by PubChem (NCBI)