6-Methoxy-1H-indazole-3-carbonitrile, 98%
cas: 691900-59-1 — see every product listed under this CAS number, including other names
6-Methoxy-1H-indazole-3-carbonitrile, 98% (CAS 691900-59-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A775709-1g |
| cas | 691900-59-1 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 231.31 Pln | |
| Ambeed | 5g | 804.25 Pln | |
| BLDpharm | 1g | 247.72 Pln | |
| BLDpharm | 5g | 703.11 Pln | |
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 198.80 Pln | |
| Chemat | 1g | 549.20 Pln | |
| Fluorochem | 100mg | 112.48 Pln | |
| Fluorochem | 250mg | 195.78 Pln | |
| Fluorochem | 1g | 544.62 Pln | |
| Fluorochem | 100mg | 112.48 Pln | |
| Fluorochem | 250mg | 195.78 Pln | |
| Fluorochem | 1g | 544.62 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
6-methoxy-1H-indazole-3-carbonitrile (CAS 691900-59-1) is a chemical compound with the molecular formula C9H7N3O and a molecular weight of 173.17 g/mol. IUPAC name: 6-methoxy-1H-indazole-3-carbonitrile. InChIKey: QAJXYNLOGLGDCG-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O |
|---|---|
| Molecular weight | 173.17 g/mol |
| IUPAC name | 6-methoxy-1H-indazole-3-carbonitrile |
| InChIKey | QAJXYNLOGLGDCG-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=NN2)C#N |
Computed by PubChem (NCBI)