cas: 31040-15-0 — see every product listed under this CAS number, including other names
6-Nitro-[1,2,4]triazolo[1,5-a]pyridin-2-amine 95% (CAS 31040-15-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A114589-100mg |
| cas | 31040-15-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 236.88 Pln | |
| Ambeed | 1g | 720.81 Pln | |
| Ambeed | 5g | 2089.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A114589 |
6-nitro-[1,2,4]triazolo[1,5-a]pyridin-2-amine (CAS 31040-15-0) is a chemical compound with the molecular formula C6H5N5O2 and a molecular weight of 179.14 g/mol. IUPAC name: 6-nitro-[1,2,4]triazolo[1,5-a]pyridin-2-amine. InChIKey: DPFDCZNFMJEQCU-UHFFFAOYSA-N.
| Molecular formula | C6H5N5O2 |
|---|---|
| Molecular weight | 179.14 g/mol |
| IUPAC name | 6-nitro-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| InChIKey | DPFDCZNFMJEQCU-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=NN2C=C1[N+](=O)[O-])N |
Computed by PubChem (NCBI)