CAS 1186608-97-8 is the registry number for 5-Nitro-1h-pyrazolo[3,4-b]pyridin-3-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
5-nitro-2H-pyrazolo[3,4-b]pyridin-3-amine (CAS 1186608-97-8) is a chemical compound with the molecular formula C6H5N5O2 and a molecular weight of 179.14 g/mol. IUPAC name: 5-nitro-2H-pyrazolo[3,4-b]pyridin-3-amine. InChIKey: AQILOAPQGZNHEG-UHFFFAOYSA-N.
| Molecular formula | C6H5N5O2 |
|---|---|
| Molecular weight | 179.14 g/mol |
| IUPAC name | 5-nitro-2H-pyrazolo[3,4-b]pyridin-3-amine |
| InChIKey | AQILOAPQGZNHEG-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=NNC(=C21)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)