cas: 59146-96-2 — see every product listed under this CAS number, including other names
6-Nitro-2,3-xylidine, >98.0%(GC) (CAS 59146-96-2) is a chemical reagent available from Chemat. Available pack sizes: 25g, 500g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | N0500-25G |
| cas | 59146-96-2 |
| size | 25g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25g | 242.77 Pln | |
| TCI | 500g | 1349.15 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
2,3-dimethyl-6-nitroaniline (CAS 59146-96-2) is a chemical compound with the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. IUPAC name: 2,3-dimethyl-6-nitroaniline. InChIKey: YEFYPFWBLCARLC-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O2 |
|---|---|
| Molecular weight | 166.18 g/mol |
| IUPAC name | 2,3-dimethyl-6-nitroaniline |
| InChIKey | YEFYPFWBLCARLC-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)[N+](=O)[O-])N)C |
Computed by PubChem (NCBI)