cas: 118803-40-0 — see every product listed under this CAS number, including other names
6-Nitrobenzo[c][1,2]oxaborol-1(3H)-ol 98% (CAS 118803-40-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A696259-250mg |
| cas | 118803-40-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 515.00 Pln | |
| Ambeed | 5g | 1377.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A696259 |
1-hydroxy-6-nitro-3H-2,1-benzoxaborole (CAS 118803-40-0) is a chemical compound with the molecular formula C7H6BNO4 and a molecular weight of 178.94 g/mol. IUPAC name: 1-hydroxy-6-nitro-3H-2,1-benzoxaborole. InChIKey: GFFKBQCIGADRSN-UHFFFAOYSA-N.
| Molecular formula | C7H6BNO4 |
|---|---|
| Molecular weight | 178.94 g/mol |
| IUPAC name | 1-hydroxy-6-nitro-3H-2,1-benzoxaborole |
| InChIKey | GFFKBQCIGADRSN-UHFFFAOYSA-N |
| SMILES | B1(C2=C(CO1)C=CC(=C2)[N+](=O)[O-])O |
Computed by PubChem (NCBI)