CAS 1016644-38-4 appears in our catalog under these names: 2-Oxo-2,3-dihydrobenzo[d]oxazol-6-yl-boronic acid, 95%, (2-Oxo-2,3-dihydrobenzo[d]oxazol-6-yl)boronic acid 96%, (2-Oxo-2,3-dihydrobenzo[d]oxazol-6-yl)boronic acid, 96%, 96%, (2-Oxo-2,3-dihydrobenzo[d]oxazol-6-yl)boronic acid, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 50mg.
(2-oxo-3H-1,3-benzoxazol-6-yl)boronic acid (CAS 1016644-38-4) is a chemical compound with the molecular formula C7H6BNO4 and a molecular weight of 178.94 g/mol. IUPAC name: (2-oxo-3H-1,3-benzoxazol-6-yl)boronic acid. InChIKey: PHZVOCDSNUZULP-UHFFFAOYSA-N.
| Molecular formula | C7H6BNO4 |
|---|---|
| Molecular weight | 178.94 g/mol |
| IUPAC name | (2-oxo-3H-1,3-benzoxazol-6-yl)boronic acid |
| InChIKey | PHZVOCDSNUZULP-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)NC(=O)O2)(O)O |
Computed by PubChem (NCBI)