cas: 13345-09-0 — see every product listed under this CAS number, including other names
6-Phenylpyrimidine-2,4(1H,3H)-dione 95% (CAS 13345-09-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A930214-100mg |
| cas | 13345-09-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 286.94 Pln | |
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 748.62 Pln | |
| Ambeed | 5g | 2295.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A930214 |
6-phenyl-1H-pyrimidine-2,4-dione (CAS 13345-09-0) is a chemical compound with the molecular formula C10H8N2O2 and a molecular weight of 188.18 g/mol. IUPAC name: 6-phenyl-1H-pyrimidine-2,4-dione. InChIKey: NCSMAVULYUCSMB-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O2 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | 6-phenyl-1H-pyrimidine-2,4-dione |
| InChIKey | NCSMAVULYUCSMB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=O)NC(=O)N2 |
Computed by PubChem (NCBI)