6-Phenylpyrimidine-2,4(1H,3H)-dione, 95%
cas: 13345-09-0 — see every product listed under this CAS number, including other names
6-Phenylpyrimidine-2,4(1H,3H)-dione, 95% (CAS 13345-09-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A930214-100mg |
| cas | 13345-09-0 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 264.69 Pln | |
| Ambeed | 250mg | 309.19 Pln | |
| Ambeed | 1g | 687.44 Pln | |
| Ambeed | 5g | 2089.19 Pln | |
| Chemat | 100mg | 376.40 Pln | |
| Chemat | 250mg | 453.20 Pln | |
| Chemat | 1g | 1038.80 Pln | |
| Chemat | 5g | 3184.40 Pln | |
| BLDpharm | 100mg | 281.04 Pln | |
| BLDpharm | 250mg | 325.47 Pln | |
| BLDpharm | 1g | 736.43 Pln | |
| BLDpharm | 5g | 2247.01 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
6-phenyl-1H-pyrimidine-2,4-dione (CAS 13345-09-0) is a chemical compound with the molecular formula C10H8N2O2 and a molecular weight of 188.18 g/mol. IUPAC name: 6-phenyl-1H-pyrimidine-2,4-dione. InChIKey: NCSMAVULYUCSMB-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O2 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | 6-phenyl-1H-pyrimidine-2,4-dione |
| InChIKey | NCSMAVULYUCSMB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=O)NC(=O)N2 |
Computed by PubChem (NCBI)
Synonyms:
6-Phenyluracil, 6-Phenyl-2,4(1H,3H)-pyrimidinedione, 2,4(1H,3H)-Pyrimidinedione, 6-phenyl-, NCSMAVULYUCSMB-UHFFFAOYSA-N, 6-phenylpyrimidine-2,4(1h,3h)-dione, 6-Phenyl-pyrimidine-2,4-diol, 6-phenylpyrimidine-2,4-diol, 6-Phenyl-1H-pyrimidine-2,4-dione, 6-phenyl-1~{H}-pyrimidine-2,4-dione, 2,4-Dihydroxy-6-phenylpyrimidine