cas: 1242268-17-2 — see every product listed under this CAS number, including other names
6-TERT-BUTYL 1-ETHYL 6-AZASPIRO[2.5]OCTANE-1,6-DICARBOXYLATE, 97% (CAS 1242268-17-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F386258-100MG |
| cas | 1242268-17-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 190.58 Pln | |
| Fluorochem | 250mg | 325.94 Pln | |
| Fluorochem | 1g | 997.58 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
6-O-tert-butyl 2-O-ethyl 6-azaspiro[2.5]octane-2,6-dicarboxylate (CAS 1242268-17-2) is a chemical compound with the molecular formula C15H25NO4 and a molecular weight of 283.36 g/mol. IUPAC name: 6-O-tert-butyl 2-O-ethyl 6-azaspiro[2.5]octane-2,6-dicarboxylate. InChIKey: MWXOEHQQUHBXTN-UHFFFAOYSA-N.
| Molecular formula | C15H25NO4 |
|---|---|
| Molecular weight | 283.36 g/mol |
| IUPAC name | 6-O-tert-butyl 2-O-ethyl 6-azaspiro[2.5]octane-2,6-dicarboxylate |
| InChIKey | MWXOEHQQUHBXTN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CC12CCN(CC2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)