6-fluorobenzofuran-3-carboxylic acid, 95%
cas: 1393561-25-5 — see every product listed under this CAS number, including other names
6-fluorobenzofuran-3-carboxylic acid, 95% (CAS 1393561-25-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F550189-100MG |
| cas | 1393561-25-5 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 159.34 Pln | |
| Fluorochem | 250mg | 284.29 Pln | |
| Fluorochem | 500mg | 513.38 Pln | |
| Fluorochem | 1g | 971.55 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
6-fluoro-1-benzofuran-3-carboxylic acid (CAS 1393561-25-5) is a chemical compound with the molecular formula C9H5FO3 and a molecular weight of 180.13 g/mol. IUPAC name: 6-fluoro-1-benzofuran-3-carboxylic acid. InChIKey: ATVWVNCCIAXRMZ-UHFFFAOYSA-N.
| Molecular formula | C9H5FO3 |
|---|---|
| Molecular weight | 180.13 g/mol |
| IUPAC name | 6-fluoro-1-benzofuran-3-carboxylic acid |
| InChIKey | ATVWVNCCIAXRMZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)OC=C2C(=O)O |
Computed by PubChem (NCBI)