Products 385808-59-3
CAS 385808-59-3 appears in our catalog under these names: 7-Fluoro-1-benzofuran-2-carboxylic acid, 95%, 7-Fluorobenzofuran-2-carboxylic acid, 97%, 7-fluorobenzofuran-2-carboxylic acid, 7-Fluorobenzofuran-2-carboxylic acid 95%, 7-Fluorobenzofuran-2-carboxylic acid, 97%, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
7-fluoro-1-benzofuran-2-carboxylic acid (CAS 385808-59-3) is a chemical compound with the molecular formula C9H5FO3 and a molecular weight of 180.13 g/mol. IUPAC name: 7-fluoro-1-benzofuran-2-carboxylic acid. InChIKey: HHCPFHBJPUWLOB-UHFFFAOYSA-N.
| Molecular formula | C9H5FO3 |
|---|---|
| Molecular weight | 180.13 g/mol |
| IUPAC name | 7-fluoro-1-benzofuran-2-carboxylic acid |
| InChIKey | HHCPFHBJPUWLOB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)F)OC(=C2)C(=O)O |
Computed by PubChem (NCBI)