cas: 1412452-82-4 — see every product listed under this CAS number, including other names
6-tert-Butyl 4-ethyl 2-hydroxy-7,8-dihydropyrido(4,3-d)pyrimidine-4,6(5H)-dicarboxylate, 97% (CAS 1412452-82-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A492680-1g |
| cas | 1412452-82-4 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 10394.86 Pln | |
| AmBeed | 5g | 30959.95 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
6-O-tert-butyl 4-O-ethyl 2-oxo-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-4,6-dicarboxylate (CAS 1412452-82-4) is a chemical compound with the molecular formula C15H21N3O5 and a molecular weight of 323.34 g/mol. IUPAC name: 6-O-tert-butyl 4-O-ethyl 2-oxo-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-4,6-dicarboxylate. InChIKey: MZLQNJKUOXNGQA-UHFFFAOYSA-N.
| Molecular formula | C15H21N3O5 |
|---|---|
| Molecular weight | 323.34 g/mol |
| IUPAC name | 6-O-tert-butyl 4-O-ethyl 2-oxo-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-4,6-dicarboxylate |
| InChIKey | MZLQNJKUOXNGQA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC(=O)NC2=C1CN(CC2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)