Products 57533-91-2

CAS 57533-91-2 is the registry number for Z-Homocit-OH. Offered by: Creative Peptides, Biosynth. Available pack sizes: 1g, 5g, 5000mg, 2000mg, 10000mg.

Structural formula: {0} (CAS {1})

(2S)-6-(carbamoylamino)-2-(phenylmethoxycarbonylamino)hexanoic acid (CAS 57533-91-2) is a chemical compound with the molecular formula C15H21N3O5 and a molecular weight of 323.34 g/mol. IUPAC name: (2S)-6-(carbamoylamino)-2-(phenylmethoxycarbonylamino)hexanoic acid. InChIKey: GDAQVXISDUMUJG-LBPRGKRZSA-N.

Identity
Molecular formulaC15H21N3O5
Molecular weight323.34 g/mol
IUPAC name(2S)-6-(carbamoylamino)-2-(phenylmethoxycarbonylamino)hexanoic acid
InChIKeyGDAQVXISDUMUJG-LBPRGKRZSA-N
SMILESC1=CC=C(C=C1)COC(=O)N[C@@H](CCCCNC(=O)N)C(=O)O

Computed by PubChem (NCBI)