CAS 1224567-46-7 appears in our catalog under these names: 653–47 hydrochloride, 653-47 hydrochloride/ 99.65% (existing batch purity), 653-47 Hydrochloride, 653-47 (hydrochloride), 653-47 (hydrochloride), 99.42%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 10mg, 100mg, 10mM (in 1ml dmso), 25mg, 5mg, 50mg, 1mg, 200mg.
3-(3-aminopropoxy)-N-(4-chloro-2-hydroxyphenyl)naphthalene-2-carboxamide;hydrochloride (CAS 1224567-46-7) is a chemical compound with the molecular formula C20H20Cl2N2O3 and a molecular weight of 407.3 g/mol. IUPAC name: 3-(3-aminopropoxy)-N-(4-chloro-2-hydroxyphenyl)naphthalene-2-carboxamide;hydrochloride. InChIKey: HESNWSHDEFHION-UHFFFAOYSA-N.
| Molecular formula | C20H20Cl2N2O3 |
|---|---|
| Molecular weight | 407.3 g/mol |
| IUPAC name | 3-(3-aminopropoxy)-N-(4-chloro-2-hydroxyphenyl)naphthalene-2-carboxamide;hydrochloride |
| InChIKey | HESNWSHDEFHION-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C(=CC2=C1)C(=O)NC3=C(C=C(C=C3)Cl)O)OCCCN.Cl |
Computed by PubChem (NCBI)