cas: 243-59-4 — see every product listed under this CAS number, including other names
6H-Indolo[2,3-b]quinoxaline, >98.0%(GC)(T) (CAS 243-59-4) is a chemical reagent available from Chemat. Available pack sizes: 200mg, 1g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | I1098-200MG |
| cas | 243-59-4 |
| size | 200mg |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 200mg | 142.93 Pln | |
| TCI | 1g | 492.06 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
6H-indolo[3,2-b]quinoxaline (CAS 243-59-4) is a chemical compound with the molecular formula C14H9N3 and a molecular weight of 219.24 g/mol. IUPAC name: 6H-indolo[3,2-b]quinoxaline. InChIKey: LCKIWLDOHFUYDV-UHFFFAOYSA-N.
| Molecular formula | C14H9N3 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | 6H-indolo[3,2-b]quinoxaline |
| InChIKey | LCKIWLDOHFUYDV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=NC4=CC=CC=C4N=C3N2 |
Computed by PubChem (NCBI)