cas: 2197056-64-5 — see every product listed under this CAS number, including other names
7'-Methylspiro(cyclopropane-1,3'-indoline) hydrochloride, 98% (CAS 2197056-64-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A2255584-250mg |
| cas | 2197056-64-5 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 6163.36 Pln | |
| AmBeed | 1g | 15303.40 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
7-methylspiro[1,2-dihydroindole-3,1'-cyclopropane];hydrochloride (CAS 2197056-64-5) is a chemical compound with the molecular formula C11H14ClN and a molecular weight of 195.69 g/mol. IUPAC name: 7-methylspiro[1,2-dihydroindole-3,1'-cyclopropane];hydrochloride. InChIKey: WLYINJXJYYXFQQ-UHFFFAOYSA-N.
| Molecular formula | C11H14ClN |
|---|---|
| Molecular weight | 195.69 g/mol |
| IUPAC name | 7-methylspiro[1,2-dihydroindole-3,1'-cyclopropane];hydrochloride |
| InChIKey | WLYINJXJYYXFQQ-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C3(CC3)CN2.Cl |
Computed by PubChem (NCBI)